Description
A methylhypoxanthine that is hypoxanthine with the methyl group at position 3.
Chemical properties
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C6H6N4O | 0 | 150.141 |
Recommended notation
| Name | 3-methylhypoxanthine |
|---|---|
| Abbreviation | 3mHyp |
Nomenclature
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 3-methyl-3,7-dihydro-6H-purin-6-one | C=12C(N=CN(C1N=CN2)C)=O | InChI=1S/C6H6N4O/c1-10-3-9-6(11)4-5(10)8-2-7-4/h2-3H,1H3,(H,7,8) | VMOIVMBFRBQQFB-UHFFFAOYSA-N |
|
Citations
- Bergmann, F, et al. 1979. Behavior of N-methylated allopurinols and related 4-thioxopyrazolo [3,4-d]pyrimidines towards bovine milk xanthine oxidase. Biochimica Et Biophysica Acta. 570(1).