A pyrimidine 2'-deoxyribonucleoside that is 5-hydroxymethyl-2'-deoxyuridine in which the hydroxymethyl group at position 5 has been formally converted to the corresponding 2-aminoethyl ether. It is a thymidine hypermodification replacing 40% of thymidine nucleotides in the Salmonellaphage ViI.
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C12H19N3O6 | 0 | 301.296 |
| Name | 5-(2-aminoethoxy)methyluridine |
|---|---|
| Abbreviation | 5-NeOmdU |
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 5-[(2-aminoethoxy)methyl]-2'-deoxyuridine | N1(C(NC(C(=C1)COCCN)=O)=O)[C@H]2C[C@@H]([C@H](O2)CO)O | InChI=1S/C12H19N3O6/c13-1-2-20-6-7-4-15(12(19)14-11(7)18)10-3-8(17)9(5-16)21-10/h4,8-10,16-17H,1-3,5-6,13H2,(H,14,18,19)/t8-,9+,10+/m0/s1 | YRTWGZACASMEIB-IVZWLZJFSA-N |
|
| Origin | Function | Functional detail |
Organisms
|
References |
|---|---|---|---|---|
| natural | hypermodified nucleobase | Enterobacteria phage ViI |
|