A pyrimidone resulting from the formal oxidation of the alcoholic hydroxy group of 5-hydroxymethyluracil to the corresponding aldehyde. It is a major one-electron photooxidation product of thymine in oligodeoxynucleotides.
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C5H4N2O3 | 0 | 140.097 |
| Name | 5-formyluracil |
|---|---|
| Abbreviation | 5fU |
| Symbol | e |
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbaldehyde | N1C(NC=C(C1=O)C=O)=O | InChI=1S/C5H4N2O3/c8-2-3-1-6-5(10)7-4(3)9/h1-2H,(H2,6,7,9,10) | OHAMXGZMZZWRCA-UHFFFAOYSA-N |
|
| Method |
Method detail
|
Resolution
|
Qualifier
|
References |
|---|---|---|---|---|
| Hardisty-labelling | chemical tagging | single-base | target sequences |
|
SMRT | direct detection | single-base |
|
| Origin | Function | Functional detail |
Organisms
|
References |
|---|---|---|---|---|
| natural | damage and demethylation intermediate | Homo sapiens |
|