A methylguanine in which the methyl group is positioned on the oxygen at position 6. Formed in DNA by alkylation of the oxygen atom of guanine, most often by N-nitroso compounds and sometimes due to methylation by other compounds such as endogenous S-adenosylmethionine, it base-pairs to thymine rather than cytidine, causing a G:C to A:T transition in DNA.
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C6H7N5O | 0 | 165.153 |
| Name | 6-O-methylguanine |
|---|---|
| Abbreviation | m6G |
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 6-methoxy-7H-purin-2-amine | COc1nc(N)nc2nc[nH]c12 | InChI=1S/C6H7N5O/c1-12-5-3-4(9-2-8-3)10-6(7)11-5/h2H,1H3,(H3,7,8,9,10,11) | BXJHWYVXLGLDMZ-UHFFFAOYSA-N |
|
| Method |
Method detail
|
Resolution
|
Qualifier
|
References |
|---|---|---|---|---|
| SMRT | direct detection | single-base | target sequences |
|