A 7-deazaguanosine ribonucleoside that has 7-carbamoyl-7-deazaguanine as the nucleobase. It is present in archaeal tRNA and has also been found in bacterial DNA.
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C12H15N5O6 | 0 | 325.278 |
| Name | 7-amido-7-deazaguanosine |
|---|---|
| Abbreviation | ADG |
| IUPAC | SMILES | InChI | InChIKey |
|---|---|---|---|
| 2-amino-4-oxo-7-beta-D-ribofuranosyl-4,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine-5-carboxamide | N1C(=NC2=C(C1=O)C(=CN2[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C(N)=O)N | InChI=1S/C12H15N5O6/c13-8(21)3-1-17(9-5(3)10(22)16-12(14)15-9)11-7(20)6(19)4(2-18)23-11/h1,4,6-7,11,18-20H,2H2,(H2,13,21)(H3,14,15,16,22)/t4-,6-,7-,11-/m1/s1 | CNQDKAFKNBVKDW-RPKMEZRRSA-N |
| Origin | Function | Functional detail |
Organisms
|
References |
|---|---|---|---|---|
| natural | restriction-modification |
|
|