A nucleobase analogue that is adenine in which one of the exocyclic amino hydrogens is replaced by a carbamoylmethyl group.
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C7H8N6O | 0 | 192.178 |
| Name | N6-carbamoylmethyladenine |
|---|---|
| Abbreviation | ncm6A |
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| N(2)-1H-purin-6-ylglycinamide | C=12C(=NC=NC1NCC(=O)N)NC=N2 | InChI=1S/C7H8N6O/c8-4(14)1-9-6-5-7(11-2-10-5)13-3-12-6/h2-3H,1H2,(H2,8,14)(H2,9,10,11,12,13) | WIFHSKZDPZUSLN-UHFFFAOYSA-N |
|
| Origin | Function | Functional detail |
Organisms
|
References |
|---|---|---|---|---|
| natural | hypermodified nucleobase | specific transcriptional roles | Enterobacteria phage Mu |
|