An N-substituted putrescine that is thymine in which a hydrogen of the methyl group has been replaced by one of the amino groups of putrescine. It replaces about half of the thymine residues in the DNA of bacetriophage phiW-14.
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C9H16N4O2 | 0 | 212.249 |
| Name | α-putrescinylthymine |
|---|---|
| Abbreviation | putThy |
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 5-{[(4-aminobutyl)amino]methyl}pyrimidine-2,4(1H,3H)-dione | N1C=C(C(NC1=O)=O)CNCCCCN | InChI=1S/C9H16N4O2/c10-3-1-2-4-11-5-7-6-12-9(15)13-8(7)14/h6,11H,1-5,10H2,(H2,12,13,14,15) | IBOLVNKLOOYDDG-UHFFFAOYSA-N |
|
| Origin | Function | Functional detail |
Organisms
|
References |
|---|---|---|---|---|
| natural | hypermodified nucleobase | bacteriophage ϕW-14 |
|